diff --git a/lldb/include/lldb/API/SBAttachInfo.h b/lldb/include/lldb/API/SBAttachInfo.h
--- a/lldb/include/lldb/API/SBAttachInfo.h
+++ b/lldb/include/lldb/API/SBAttachInfo.h
@@ -168,6 +168,25 @@
   /// allows a different listener to be used to listen for process events.
   void SetListener(SBListener &listener);
 
+  /// Get the shadow listener that receive public process events,
+  /// additionally to the default process event listener.
+  ///
+  /// If no listener has been set via a call to
+  /// SBLaunchInfo::SetShadowListener(), then an invalid SBListener will
+  /// be returned (SBListener::IsValid() will return false). If a listener
+  /// has been set, then the valid listener object will be returned.
+  SBListener GetShadowListener();
+
+  /// Set the shadow listener that will receive public process events,
+  /// additionally to the default process event listener.
+  ///
+  /// By default a process have no shadow event listener.
+  /// Calling this function allows public process events to be broadcasted to an
+  /// additional listener on top of the default process event listener.
+  /// If the `listener` argument is invalid (SBListener::IsValid() will
+  /// return false), this will clear the shadow listener.
+  void SetShadowListener(SBListener &listener);
+
   const char *GetScriptedProcessClassName() const;
 
   void SetScriptedProcessClassName(const char *class_name);
diff --git a/lldb/include/lldb/API/SBLaunchInfo.h b/lldb/include/lldb/API/SBLaunchInfo.h
--- a/lldb/include/lldb/API/SBLaunchInfo.h
+++ b/lldb/include/lldb/API/SBLaunchInfo.h
@@ -92,6 +92,25 @@
   /// allows a different listener to be used to listen for process events.
   void SetListener(SBListener &listener);
 
+  /// Get the shadow listener that receive public process events,
+  /// additionally to the default process event listener.
+  ///
+  /// If no listener has been set via a call to
+  /// SBLaunchInfo::SetShadowListener(), then an invalid SBListener will
+  /// be returned (SBListener::IsValid() will return false). If a listener
+  /// has been set, then the valid listener object will be returned.
+  SBListener GetShadowListener();
+
+  /// Set the shadow listener that will receive public process events,
+  /// additionally to the default process event listener.
+  ///
+  /// By default a process have no shadow event listener.
+  /// Calling this function allows public process events to be broadcasted to an
+  /// additional listener on top of the default process event listener.
+  /// If the `listener` argument is invalid (SBListener::IsValid() will
+  /// return false), this will clear the shadow listener.
+  void SetShadowListener(SBListener &listener);
+
   uint32_t GetNumArguments();
 
   const char *GetArgumentAtIndex(uint32_t idx);
diff --git a/lldb/include/lldb/Target/Process.h b/lldb/include/lldb/Target/Process.h
--- a/lldb/include/lldb/Target/Process.h
+++ b/lldb/include/lldb/Target/Process.h
@@ -380,6 +380,10 @@
     return GetStaticBroadcasterClass();
   }
 
+  void SetShadowListener(lldb::ListenerSP listener_sp) override {
+    Broadcaster::SetShadowListener(listener_sp);
+  }
+
 /// A notification structure that can be used by clients to listen
 /// for changes in a process's lifetime.
 ///
diff --git a/lldb/include/lldb/Utility/Broadcaster.h b/lldb/include/lldb/Utility/Broadcaster.h
--- a/lldb/include/lldb/Utility/Broadcaster.h
+++ b/lldb/include/lldb/Utility/Broadcaster.h
@@ -406,6 +406,10 @@
 
   lldb::BroadcasterManagerSP GetManager();
 
+  virtual void SetShadowListener(lldb::ListenerSP listener_sp) {
+    m_broadcaster_sp->m_shadow_listener = listener_sp;
+  }
+
 protected:
   /// BroadcasterImpl contains the actual Broadcaster implementation.  The
   /// Broadcaster makes a BroadcasterImpl which lives as long as it does.  The
@@ -513,6 +517,10 @@
     /// for now this is just for private hijacking.
     std::vector<uint32_t> m_hijacking_masks;
 
+    /// A optional listener that all private events get also broadcasted to,
+    /// on top the hijacked / default listeners.
+    lldb::ListenerSP m_shadow_listener = nullptr;
+
   private:
     BroadcasterImpl(const BroadcasterImpl &) = delete;
     const BroadcasterImpl &operator=(const BroadcasterImpl &) = delete;
diff --git a/lldb/include/lldb/Utility/Listener.h b/lldb/include/lldb/Utility/Listener.h
--- a/lldb/include/lldb/Utility/Listener.h
+++ b/lldb/include/lldb/Utility/Listener.h
@@ -95,6 +95,8 @@
 
   size_t HandleBroadcastEvent(lldb::EventSP &event_sp);
 
+  void SetShadow(bool is_shadow) { m_is_shadow = is_shadow; }
+
 private:
   // Classes that inherit from Listener can see and modify these
   struct BroadcasterInfo {
@@ -134,6 +136,7 @@
   std::mutex m_events_mutex; // Protects m_broadcasters and m_events
   std::condition_variable m_events_condition;
   broadcaster_manager_collection m_broadcaster_managers;
+  bool m_is_shadow = false;
 
   void BroadcasterWillDestruct(Broadcaster *);
 
diff --git a/lldb/include/lldb/Utility/ProcessInfo.h b/lldb/include/lldb/Utility/ProcessInfo.h
--- a/lldb/include/lldb/Utility/ProcessInfo.h
+++ b/lldb/include/lldb/Utility/ProcessInfo.h
@@ -110,6 +110,12 @@
     m_hijack_listener_sp = listener_sp;
   }
 
+  lldb::ListenerSP GetShadowListener() const { return m_shadow_listener_sp; }
+
+  void SetShadowListener(const lldb::ListenerSP &listener_sp) {
+    m_shadow_listener_sp = listener_sp;
+  }
+
 protected:
   FileSpec m_executable;
   std::string m_arg0; // argv[0] if supported. If empty, then use m_executable.
@@ -124,6 +130,7 @@
   lldb::ScriptedMetadataSP m_scripted_metadata_sp = nullptr;
   lldb::ListenerSP m_listener_sp = nullptr;
   lldb::ListenerSP m_hijack_listener_sp = nullptr;
+  lldb::ListenerSP m_shadow_listener_sp = nullptr;
 };
 
 // ProcessInstanceInfo
diff --git a/lldb/source/API/SBAttachInfo.cpp b/lldb/source/API/SBAttachInfo.cpp
--- a/lldb/source/API/SBAttachInfo.cpp
+++ b/lldb/source/API/SBAttachInfo.cpp
@@ -254,6 +254,27 @@
   m_opaque_sp->SetListener(listener.GetSP());
 }
 
+SBListener SBAttachInfo::GetShadowListener() {
+  LLDB_INSTRUMENT_VA(this);
+
+  lldb::ListenerSP shadow_sp = m_opaque_sp->GetShadowListener();
+  if (!shadow_sp)
+    return SBListener();
+  return SBListener(shadow_sp);
+}
+
+void SBAttachInfo::SetShadowListener(SBListener &listener) {
+  LLDB_INSTRUMENT_VA(this, listener);
+
+  ListenerSP listener_sp = listener.GetSP();
+  if (listener_sp && listener.IsValid())
+    listener_sp->SetShadow(true);
+  else
+    listener_sp = nullptr;
+
+  m_opaque_sp->SetShadowListener(listener_sp);
+}
+
 const char *SBAttachInfo::GetScriptedProcessClassName() const {
   LLDB_INSTRUMENT_VA(this);
 
diff --git a/lldb/source/API/SBLaunchInfo.cpp b/lldb/source/API/SBLaunchInfo.cpp
--- a/lldb/source/API/SBLaunchInfo.cpp
+++ b/lldb/source/API/SBLaunchInfo.cpp
@@ -17,6 +17,7 @@
 #include "lldb/API/SBStructuredData.h"
 #include "lldb/Core/StructuredDataImpl.h"
 #include "lldb/Host/ProcessLaunchInfo.h"
+#include "lldb/Utility/Listener.h"
 #include "lldb/Utility/ScriptedMetadata.h"
 
 using namespace lldb;
@@ -387,3 +388,24 @@
   metadata_sp = std::make_shared<ScriptedMetadata>(class_name, dict_sp);
   m_opaque_sp->SetScriptedMetadata(metadata_sp);
 }
+
+SBListener SBLaunchInfo::GetShadowListener() {
+  LLDB_INSTRUMENT_VA(this);
+
+  lldb::ListenerSP shadow_sp = m_opaque_sp->GetShadowListener();
+  if (!shadow_sp)
+    return SBListener();
+  return SBListener(shadow_sp);
+}
+
+void SBLaunchInfo::SetShadowListener(SBListener &listener) {
+  LLDB_INSTRUMENT_VA(this, listener);
+
+  ListenerSP listener_sp = listener.GetSP();
+  if (listener_sp && listener.IsValid())
+    listener_sp->SetShadow(true);
+  else
+    listener_sp = nullptr;
+
+  m_opaque_sp->SetShadowListener(listener_sp);
+}
diff --git a/lldb/source/Plugins/Platform/POSIX/PlatformPOSIX.cpp b/lldb/source/Plugins/Platform/POSIX/PlatformPOSIX.cpp
--- a/lldb/source/Plugins/Platform/POSIX/PlatformPOSIX.cpp
+++ b/lldb/source/Plugins/Platform/POSIX/PlatformPOSIX.cpp
@@ -401,6 +401,7 @@
           attach_info.SetHijackListener(listener_sp);
         }
         process_sp->HijackProcessEvents(listener_sp);
+        process_sp->SetShadowListener(attach_info.GetShadowListener());
         error = process_sp->Attach(attach_info);
       }
     }
@@ -458,6 +459,7 @@
   LLDB_LOG(log, "successfully created process");
 
   process_sp->HijackProcessEvents(launch_info.GetHijackListener());
+  process_sp->SetShadowListener(launch_info.GetShadowListener());
 
   // Log file actions.
   if (log) {
diff --git a/lldb/source/Plugins/Platform/gdb-server/PlatformRemoteGDBServer.cpp b/lldb/source/Plugins/Platform/gdb-server/PlatformRemoteGDBServer.cpp
--- a/lldb/source/Plugins/Platform/gdb-server/PlatformRemoteGDBServer.cpp
+++ b/lldb/source/Plugins/Platform/gdb-server/PlatformRemoteGDBServer.cpp
@@ -423,6 +423,7 @@
 
         if (process_sp) {
           process_sp->HijackProcessEvents(launch_info.GetHijackListener());
+          process_sp->SetShadowListener(launch_info.GetShadowListener());
 
           error = process_sp->ConnectRemote(connect_url.c_str());
           // Retry the connect remote one time...
@@ -515,6 +516,7 @@
               ListenerSP listener_sp = attach_info.GetHijackListener();
               if (listener_sp)
                 process_sp->HijackProcessEvents(listener_sp);
+              process_sp->SetShadowListener(attach_info.GetShadowListener());
               error = process_sp->Attach(attach_info);
             }
 
diff --git a/lldb/source/Target/Target.cpp b/lldb/source/Target/Target.cpp
--- a/lldb/source/Target/Target.cpp
+++ b/lldb/source/Target/Target.cpp
@@ -3194,6 +3194,7 @@
     // Since we didn't have a platform launch the process, launch it here.
     if (m_process_sp) {
       m_process_sp->HijackProcessEvents(launch_info.GetHijackListener());
+      m_process_sp->SetShadowListener(launch_info.GetShadowListener());
       error = m_process_sp->Launch(launch_info);
     }
   }
diff --git a/lldb/source/Utility/Broadcaster.cpp b/lldb/source/Utility/Broadcaster.cpp
--- a/lldb/source/Utility/Broadcaster.cpp
+++ b/lldb/source/Utility/Broadcaster.cpp
@@ -228,6 +228,8 @@
                       &m_broadcaster, event_type))
       return;
     hijacking_listener_sp->AddEvent(event_sp);
+    if (m_shadow_listener)
+      m_shadow_listener->AddEvent(event_sp);
   } else {
     for (auto &pair : GetListeners()) {
       if (!(pair.second & event_type))
@@ -237,6 +239,8 @@
         continue;
 
       pair.first->AddEvent(event_sp);
+      if (m_shadow_listener)
+        m_shadow_listener->AddEvent(event_sp);
     }
   }
 }
diff --git a/lldb/source/Utility/Listener.cpp b/lldb/source/Utility/Listener.cpp
--- a/lldb/source/Utility/Listener.cpp
+++ b/lldb/source/Utility/Listener.cpp
@@ -35,7 +35,7 @@
 
 Listener::Listener(const char *name)
     : m_name(name), m_broadcasters(), m_broadcasters_mutex(), m_events(),
-      m_events_mutex() {
+      m_events_mutex(), m_is_shadow() {
   Log *log = GetLog(LLDBLog::Object);
   if (log != nullptr)
     LLDB_LOGF(log, "%p Listener::Listener('%s')", static_cast<void *>(this),
@@ -302,7 +302,8 @@
       // to return it so it should be okay to get the next event off the queue
       // here - and it might be useful to do that in the "DoOnRemoval".
       lock.unlock();
-      event_sp->DoOnRemoval();
+      if (!m_is_shadow)
+        event_sp->DoOnRemoval();
     }
     return true;
   }
diff --git a/lldb/source/Utility/ProcessInfo.cpp b/lldb/source/Utility/ProcessInfo.cpp
--- a/lldb/source/Utility/ProcessInfo.cpp
+++ b/lldb/source/Utility/ProcessInfo.cpp
@@ -23,13 +23,13 @@
 
 ProcessInfo::ProcessInfo()
     : m_executable(), m_arguments(), m_environment(), m_arch(), m_listener_sp(),
-      m_hijack_listener_sp(), m_passthrough_listener_sp() {}
+      m_hijack_listener_sp(), m_shadow_listener_sp() {}
 
 ProcessInfo::ProcessInfo(const char *name, const ArchSpec &arch,
                          lldb::pid_t pid)
     : m_executable(name), m_arguments(), m_environment(), m_arch(arch),
       m_pid(pid), m_listener_sp(), m_hijack_listener_sp(),
-      m_passthrough_listener_sp() {}
+      m_shadow_listener_sp() {}
 
 void ProcessInfo::Clear() {
   m_executable.Clear();